C16H28NO6- — CID 71402183
2-[2-[2-[bis(2-hydroxyethyl)amino]ethoxy]-2-oxoethyl]oct-3-enoate (PubChem CID 71402183) has the molecular formula C16H28NO6- and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-[2-[2-[bis(2-hydroxyethyl)amino]ethoxy]-2-oxoethyl]oct-3-enoate.
| Compound Name | 2-[2-[2-[bis(2-hydroxyethyl)amino]ethoxy]-2-oxoethyl]oct-3-enoate |
|---|---|
| PubChem CID | 71402183 |
| Molecular Formula | C16H28NO6- |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[2-[2-[bis(2-hydroxyethyl)amino]ethoxy]-2-oxoethyl]oct-3-enoate |
| SMILES | CCCCC=CC(CC(=O)OCCN(CCO)CCO)C(=O)[O-] |
| InChI | InChI=1S/C16H29NO6/c1-2-3-4-5-6-14(16(21)22)13-15(20)23-12-9-17(7-10-18)8-11-19/h5-6,14,18-19H,2-4,7-13H2,1H3,(H,21,22)/p-1 |
| InChIKey | DNQMQZGHJWLXSG-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|