C24H46N2O6 — CID 141484962
N,N,N',N'-tetrakis(3-hydroxypropyl)-2-oct-1-enylbutanediamide (PubChem CID 141484962) has the molecular formula C24H46N2O6 and a molecular weight of 458.64 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(3-hydroxypropyl)-2-oct-1-enylbutanediamide.
| Compound Name | N,N,N',N'-tetrakis(3-hydroxypropyl)-2-oct-1-enylbutanediamide |
|---|---|
| PubChem CID | 141484962 |
| Molecular Formula | C24H46N2O6 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | N,N,N',N'-tetrakis(3-hydroxypropyl)-2-oct-1-enylbutanediamide |
| SMILES | CCCCCCC=CC(CC(=O)N(CCCO)CCCO)C(=O)N(CCCO)CCCO |
| InChI | InChI=1S/C24H46N2O6/c1-2-3-4-5-6-7-12-22(24(32)26(15-10-19-29)16-11-20-30)21-23(31)25(13-8-17-27)14-9-18-28/h7,12,22,27-30H,2-6,8-11,13-21H2,1H3 |
| InChIKey | QAKLRTRQVARQTE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|