C18H25F3N2O2S — CID 141487451
tert-butyl N-[3-[(2R,3S,5R)-3,5-difluoro-2,5-dimethyl-6-sulfanylpiperidin-2-yl]-4-fluorophenyl]carbamate (PubChem CID 141487451) has the molecular formula C18H25F3N2O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is tert-butyl N-[3-[(2R,3S,5R)-3,5-difluoro-2,5-dimethyl-6-sulfanylpiperidin-2-yl]-4-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2R,3S,5R)-3,5-difluoro-2,5-dimethyl-6-sulfanylpiperidin-2-yl]-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 141487451 |
| Molecular Formula | C18H25F3N2O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | tert-butyl N-[3-[(2R,3S,5R)-3,5-difluoro-2,5-dimethyl-6-sulfanylpiperidin-2-yl]-4-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(F)c([C@@]2(C)NC(S)[C@](C)(F)C[C@@H]2F)c1 |
| InChI | InChI=1S/C18H25F3N2O2S/c1-16(2,3)25-15(24)22-10-6-7-12(19)11(8-10)18(5)13(20)9-17(4,21)14(26)23-18/h6-8,13-14,23,26H,9H2,1-5H3,(H,22,24)/t13-,14?,17+,18+/m0/s1 |
| InChIKey | PTUZFKSPQRXDEV-DFKWNZJOSA-N |
| XLogP | 4.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|