C17H21F3N2O2S — CID 126591085
tert-butyl N-[3-(3,3-difluoro-5-methyl-6-sulfanylidenepiperidin-2-yl)-4-fluorophenyl]carbamate (PubChem CID 126591085) has the molecular formula C17H21F3N2O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is tert-butyl N-[3-(3,3-difluoro-5-methyl-6-sulfanylidenepiperidin-2-yl)-4-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[3-(3,3-difluoro-5-methyl-6-sulfanylidenepiperidin-2-yl)-4-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 126591085 |
| Molecular Formula | C17H21F3N2O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | tert-butyl N-[3-(3,3-difluoro-5-methyl-6-sulfanylidenepiperidin-2-yl)-4-fluorophenyl]carbamate |
| SMILES | CC1CC(F)(F)C(c2cc(NC(=O)OC(C)(C)C)ccc2F)NC1=S |
| InChI | InChI=1S/C17H21F3N2O2S/c1-9-8-17(19,20)13(22-14(9)25)11-7-10(5-6-12(11)18)21-15(23)24-16(2,3)4/h5-7,9,13H,8H2,1-4H3,(H,21,23)(H,22,25) |
| InChIKey | VMKLWUSQAKKIEF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|