C23H19ClFN3O4S — CID 141488516
7-chloro-N-(4-fluorophenyl)sulfonyl-4-(3-methoxyanilino)-1-methylindole-2-carboxamide (PubChem CID 141488516) has the molecular formula C23H19ClFN3O4S and a molecular weight of 487.94 g/mol. Its IUPAC name is 7-chloro-N-(4-fluorophenyl)sulfonyl-4-(3-methoxyanilino)-1-methylindole-2-carboxamide.
| Compound Name | 7-chloro-N-(4-fluorophenyl)sulfonyl-4-(3-methoxyanilino)-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 141488516 |
| Molecular Formula | C23H19ClFN3O4S |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 7-chloro-N-(4-fluorophenyl)sulfonyl-4-(3-methoxyanilino)-1-methylindole-2-carboxamide |
| SMILES | COc1cccc(Nc2ccc(Cl)c3c2cc(C(=O)NS(=O)(=O)c2ccc(F)cc2)n3C)c1 |
| InChI | InChI=1S/C23H19ClFN3O4S/c1-28-21(23(29)27-33(30,31)17-8-6-14(25)7-9-17)13-18-20(11-10-19(24)22(18)28)26-15-4-3-5-16(12-15)32-2/h3-13,26H,1-2H3,(H,27,29) |
| InChIKey | RNXQGJQSNYLCNH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |