C23H20ClN3O5S — CID 141488775
6-chloro-4-(3-methoxyanilino)-N-(4-methoxyphenyl)sulfonyl-1H-indole-2-carboxamide (PubChem CID 141488775) has the molecular formula C23H20ClN3O5S and a molecular weight of 485.95 g/mol. Its IUPAC name is 6-chloro-4-(3-methoxyanilino)-N-(4-methoxyphenyl)sulfonyl-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-4-(3-methoxyanilino)-N-(4-methoxyphenyl)sulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 141488775 |
| Molecular Formula | C23H20ClN3O5S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 6-chloro-4-(3-methoxyanilino)-N-(4-methoxyphenyl)sulfonyl-1H-indole-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)c2cc3c(Nc4cccc(OC)c4)cc(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C23H20ClN3O5S/c1-31-16-6-8-18(9-7-16)33(29,30)27-23(28)22-13-19-20(10-14(24)11-21(19)26-22)25-15-4-3-5-17(12-15)32-2/h3-13,25-26H,1-2H3,(H,27,28) |
| InChIKey | NSOXWMKLYCMRNM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |