C23H17F3N4O6S — CID 141488696
4-(3-methoxyanilino)-7-nitro-N-[4-(trifluoromethyl)phenyl]sulfonyl-1H-indole-2-carboxamide (PubChem CID 141488696) has the molecular formula C23H17F3N4O6S and a molecular weight of 534.47 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-7-nitro-N-[4-(trifluoromethyl)phenyl]sulfonyl-1H-indole-2-carboxamide.
| Compound Name | 4-(3-methoxyanilino)-7-nitro-N-[4-(trifluoromethyl)phenyl]sulfonyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 141488696 |
| Molecular Formula | C23H17F3N4O6S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | 4-(3-methoxyanilino)-7-nitro-N-[4-(trifluoromethyl)phenyl]sulfonyl-1H-indole-2-carboxamide |
| SMILES | COc1cccc(Nc2ccc([N+](=O)[O-])c3[nH]c(C(=O)NS(=O)(=O)c4ccc(C(F)(F)F)cc4)cc23)c1 |
| InChI | InChI=1S/C23H17F3N4O6S/c1-36-15-4-2-3-14(11-15)27-18-9-10-20(30(32)33)21-17(18)12-19(28-21)22(31)29-37(34,35)16-7-5-13(6-8-16)23(24,25)26/h2-12,27-28H,1H3,(H,29,31) |
| InChIKey | FCQOENRQXOWYBW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 143.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|