C24H20N4O7S — CID 148704936
4-(3-acetamidophenyl)-N-(4-methoxyphenyl)sulfonyl-7-nitro-1H-indole-2-carboxamide (PubChem CID 148704936) has the molecular formula C24H20N4O7S and a molecular weight of 508.51 g/mol. Its IUPAC name is 4-(3-acetamidophenyl)-N-(4-methoxyphenyl)sulfonyl-7-nitro-1H-indole-2-carboxamide.
| Compound Name | 4-(3-acetamidophenyl)-N-(4-methoxyphenyl)sulfonyl-7-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 148704936 |
| Molecular Formula | C24H20N4O7S |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 4-(3-acetamidophenyl)-N-(4-methoxyphenyl)sulfonyl-7-nitro-1H-indole-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)c2cc3c(-c4cccc(NC(C)=O)c4)ccc([N+](=O)[O-])c3[nH]2)cc1 |
| InChI | InChI=1S/C24H20N4O7S/c1-14(29)25-16-5-3-4-15(12-16)19-10-11-22(28(31)32)23-20(19)13-21(26-23)24(30)27-36(33,34)18-8-6-17(35-2)7-9-18/h3-13,26H,1-2H3,(H,25,29)(H,27,30) |
| InChIKey | NWBVAQWYAKYBIW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 160.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|