C24H19F3N4O7S — CID 141488537
N-(4-methoxyphenyl)sulfonyl-4-[3-methoxy-5-(trifluoromethyl)anilino]-7-nitro-1H-indole-2-carboxamide (PubChem CID 141488537) has the molecular formula C24H19F3N4O7S and a molecular weight of 564.50 g/mol. Its IUPAC name is N-(4-methoxyphenyl)sulfonyl-4-[3-methoxy-5-(trifluoromethyl)anilino]-7-nitro-1H-indole-2-carboxamide.
| Compound Name | N-(4-methoxyphenyl)sulfonyl-4-[3-methoxy-5-(trifluoromethyl)anilino]-7-nitro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 141488537 |
| Molecular Formula | C24H19F3N4O7S |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | N-(4-methoxyphenyl)sulfonyl-4-[3-methoxy-5-(trifluoromethyl)anilino]-7-nitro-1H-indole-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NC(=O)c2cc3c(Nc4cc(OC)cc(C(F)(F)F)c4)ccc([N+](=O)[O-])c3[nH]2)cc1 |
| InChI | InChI=1S/C24H19F3N4O7S/c1-37-15-3-5-17(6-4-15)39(35,36)30-23(32)20-12-18-19(7-8-21(31(33)34)22(18)29-20)28-14-9-13(24(25,26)27)10-16(11-14)38-2/h3-12,28-29H,1-2H3,(H,30,32) |
| InChIKey | BKULCOJXTYAVFY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|