C16H10F3N3O5 — CID 141488777
7-nitro-4-[3-(trifluoromethoxy)anilino]-1H-indole-2-carboxylic acid (PubChem CID 141488777) has the molecular formula C16H10F3N3O5 and a molecular weight of 381.27 g/mol. Its IUPAC name is 7-nitro-4-[3-(trifluoromethoxy)anilino]-1H-indole-2-carboxylic acid.
| Compound Name | 7-nitro-4-[3-(trifluoromethoxy)anilino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 141488777 |
| Molecular Formula | C16H10F3N3O5 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 7-nitro-4-[3-(trifluoromethoxy)anilino]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(Nc3cccc(OC(F)(F)F)c3)ccc([N+](=O)[O-])c2[nH]1 |
| InChI | InChI=1S/C16H10F3N3O5/c17-16(18,19)27-9-3-1-2-8(6-9)20-11-4-5-13(22(25)26)14-10(11)7-12(21-14)15(23)24/h1-7,20-21H,(H,23,24) |
| InChIKey | QJAGTGYBLMFJSV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|