C18H15N3O6 — CID 141488536
ethyl 4-(1,3-benzodioxol-5-ylamino)-7-nitro-1H-indole-2-carboxylate (PubChem CID 141488536) has the molecular formula C18H15N3O6 and a molecular weight of 369.33 g/mol. Its IUPAC name is ethyl 4-(1,3-benzodioxol-5-ylamino)-7-nitro-1H-indole-2-carboxylate.
| Compound Name | ethyl 4-(1,3-benzodioxol-5-ylamino)-7-nitro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 141488536 |
| Molecular Formula | C18H15N3O6 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | ethyl 4-(1,3-benzodioxol-5-ylamino)-7-nitro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(Nc3ccc4c(c3)OCO4)ccc([N+](=O)[O-])c2[nH]1 |
| InChI | InChI=1S/C18H15N3O6/c1-2-25-18(22)13-8-11-12(4-5-14(21(23)24)17(11)20-13)19-10-3-6-15-16(7-10)27-9-26-15/h3-8,19-20H,2,9H2,1H3 |
| InChIKey | CNZWUMZBEYKMQP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|