C17H15N3O6 — CID 141488870
4-(2,4-dimethoxyanilino)-7-nitro-1H-indole-2-carboxylic acid (PubChem CID 141488870) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is 4-(2,4-dimethoxyanilino)-7-nitro-1H-indole-2-carboxylic acid.
| Compound Name | 4-(2,4-dimethoxyanilino)-7-nitro-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 141488870 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-(2,4-dimethoxyanilino)-7-nitro-1H-indole-2-carboxylic acid |
| SMILES | COc1ccc(Nc2ccc([N+](=O)[O-])c3[nH]c(C(=O)O)cc23)c(OC)c1 |
| InChI | InChI=1S/C17H15N3O6/c1-25-9-3-4-12(15(7-9)26-2)18-11-5-6-14(20(23)24)16-10(11)8-13(19-16)17(21)22/h3-8,18-19H,1-2H3,(H,21,22) |
| InChIKey | FLZWDZMCAAONAE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|