C5H4N4O2 — CID 141489053
6-nitro-2,4-dihydropyrrolo[2,3-d]imidazole (PubChem CID 141489053) has the molecular formula C5H4N4O2 and a molecular weight of 152.11 g/mol. Its IUPAC name is 6-nitro-2,4-dihydropyrrolo[2,3-d]imidazole.
| Compound Name | 6-nitro-2,4-dihydropyrrolo[2,3-d]imidazole |
|---|---|
| PubChem CID | 141489053 |
| Molecular Formula | C5H4N4O2 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.03 |
| IUPAC Name | 6-nitro-2,4-dihydropyrrolo[2,3-d]imidazole |
| SMILES | O=[N+]([O-])c1c[nH]c2c1=NCN=2 |
| InChI | InChI=1S/C5H4N4O2/c10-9(11)3-1-6-5-4(3)7-2-8-5/h1H,2H2,(H,6,8) |
| InChIKey | MTYSGXBNEWIWBN-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|