C21H24ClN3O — CID 141490391
N-(3-chloro-4-pyridinyl)-2-[1-(3,3-dimethylbutyl)indol-3-yl]acetamide (PubChem CID 141490391) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is N-(3-chloro-4-pyridinyl)-2-[1-(3,3-dimethylbutyl)indol-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-pyridinyl)-2-[1-(3,3-dimethylbutyl)indol-3-yl]acetamide |
|---|---|
| PubChem CID | 141490391 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-(3-chloro-4-pyridinyl)-2-[1-(3,3-dimethylbutyl)indol-3-yl]acetamide |
| SMILES | CC(C)(C)CCn1cc(CC(=O)Nc2ccncc2Cl)c2ccccc21 |
| InChI | InChI=1S/C21H24ClN3O/c1-21(2,3)9-11-25-14-15(16-6-4-5-7-19(16)25)12-20(26)24-18-8-10-23-13-17(18)22/h4-8,10,13-14H,9,11-12H2,1-3H3,(H,23,24,26) |
| InChIKey | MLVQOROTXFRKKL-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |