C14H15F2NO3 — CID 141490437
ethyl (Z)-4-(2,4-difluorophenyl)-3-(dimethylamino)-4-oxobut-2-enoate (PubChem CID 141490437) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is ethyl (Z)-4-(2,4-difluorophenyl)-3-(dimethylamino)-4-oxobut-2-enoate.
| Compound Name | ethyl (Z)-4-(2,4-difluorophenyl)-3-(dimethylamino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 141490437 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | ethyl (Z)-4-(2,4-difluorophenyl)-3-(dimethylamino)-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C(/C(=O)c1ccc(F)cc1F)N(C)C |
| InChI | InChI=1S/C14H15F2NO3/c1-4-20-13(18)8-12(17(2)3)14(19)10-6-5-9(15)7-11(10)16/h5-8H,4H2,1-3H3/b12-8- |
| InChIKey | IZQSFPKFALGECY-WQLSENKSSA-N |
| XLogP | 2.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|