C12H14O2 — CID 141492714
[2-[(1E)-buta-1,3-dienyl]-3-methoxyphenyl]methanol (PubChem CID 141492714) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is [2-[(1E)-buta-1,3-dienyl]-3-methoxyphenyl]methanol.
| Compound Name | [2-[(1E)-buta-1,3-dienyl]-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 141492714 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | [2-[(1E)-buta-1,3-dienyl]-3-methoxyphenyl]methanol |
| SMILES | C=C/C=C/c1c(CO)cccc1OC |
| InChI | InChI=1S/C12H14O2/c1-3-4-7-11-10(9-13)6-5-8-12(11)14-2/h3-8,13H,1,9H2,2H3/b7-4+ |
| InChIKey | VOPPUDPEYISDAE-QPJJXVBHSA-N |
| XLogP | 2.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|