C9H4F6OS — CID 141493522
1-(1,2,2-trifluoroethenoxysulfanyl)-4-(trifluoromethyl)benzene (PubChem CID 141493522) has the molecular formula C9H4F6OS and a molecular weight of 274.19 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethenoxysulfanyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(1,2,2-trifluoroethenoxysulfanyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 141493522 |
| Molecular Formula | C9H4F6OS |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 1-(1,2,2-trifluoroethenoxysulfanyl)-4-(trifluoromethyl)benzene |
| SMILES | FC(F)=C(F)OSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H4F6OS/c10-7(11)8(12)16-17-6-3-1-5(2-4-6)9(13,14)15/h1-4H |
| InChIKey | BKYXDDRHWWHGAX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|