About [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate
[4-(trifluoromethyl)phenyl] N-methylcarbamodithioate (PubChem CID 23297129) has the molecular formula C9H8F3NS2
and a molecular weight of 251.30 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate.
Molecular Properties
| Compound Name | [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate |
| PubChem CID | 23297129 |
| Molecular Formula | C9H8F3NS2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate |
| SMILES | CNC(=S)Sc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F3NS2/c1-13-8(14)15-7-4-2-6(3-5-7)9(10,11)12/h2-5H,1H3,(H,13,14) |
| InChIKey | UGWBWZVLYXODEA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate?
The IUPAC name of [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate (CID 23297129) is [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate.
What is the SMILES notation for [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate?
The canonical SMILES for [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate is CNC(=S)Sc1ccc(C(F)(F)F)cc1.
What is the InChIKey of [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate?
The InChIKey is UGWBWZVLYXODEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F3NS2/c1-13-8(14)15-7-4-2-6(3-5-7)9(10,11)12/h2-5H,1H3,(H,13,14).
What are the key properties of [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate?
[4-(trifluoromethyl)phenyl] N-methylcarbamodithioate has a molecular weight of 251.30 g/mol, XLogP of 3.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(trifluoromethyl)phenyl] N-methylcarbamodithioate is sourced from PubChem (CID 23297129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).