C15H13F3O4S — CID 58599721
2,2,2-trifluoro-1-[4-(4-methylperoxysulfanylphenyl)phenyl]ethane-1,1-diol (PubChem CID 58599721) has the molecular formula C15H13F3O4S and a molecular weight of 346.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(4-methylperoxysulfanylphenyl)phenyl]ethane-1,1-diol.
| Compound Name | 2,2,2-trifluoro-1-[4-(4-methylperoxysulfanylphenyl)phenyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 58599721 |
| Molecular Formula | C15H13F3O4S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(4-methylperoxysulfanylphenyl)phenyl]ethane-1,1-diol |
| SMILES | COOSc1ccc(-c2ccc(C(O)(O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C15H13F3O4S/c1-21-22-23-13-8-4-11(5-9-13)10-2-6-12(7-3-10)14(19,20)15(16,17)18/h2-9,19-20H,1H3 |
| InChIKey | RGRMPFLZUNDPSP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|