C20H30O5 — CID 141495039
20,20,20-trihydroxyicosa-2,4,6,8,10-pentaenoic acid (PubChem CID 141495039) has the molecular formula C20H30O5 and a molecular weight of 350.45 g/mol. Its IUPAC name is 20,20,20-trihydroxyicosa-2,4,6,8,10-pentaenoic acid.
| Compound Name | 20,20,20-trihydroxyicosa-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 141495039 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 20,20,20-trihydroxyicosa-2,4,6,8,10-pentaenoic acid |
| SMILES | O=C(O)C=CC=CC=CC=CC=CCCCCCCCCC(O)(O)O |
| InChI | InChI=1S/C20H30O5/c21-19(22)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(23,24)25/h1-3,5,7,9,11,13,15,17,23-25H,4,6,8,10,12,14,16,18H2,(H,21,22) |
| InChIKey | ITSSJJJMNZNWMD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|