C15H26O2 — CID 151728816
(2E,4E)-12,12-dimethyltrideca-2,4-dienoic acid (PubChem CID 151728816) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2E,4E)-12,12-dimethyltrideca-2,4-dienoic acid.
| Compound Name | (2E,4E)-12,12-dimethyltrideca-2,4-dienoic acid |
|---|---|
| PubChem CID | 151728816 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2E,4E)-12,12-dimethyltrideca-2,4-dienoic acid |
| SMILES | CC(C)(C)CCCCCC/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C15H26O2/c1-15(2,3)13-11-9-7-5-4-6-8-10-12-14(16)17/h6,8,10,12H,4-5,7,9,11,13H2,1-3H3,(H,16,17)/b8-6+,12-10+ |
| InChIKey | RKDHAVITAQUZLL-VTKKNFPDSA-N |
| XLogP | 4.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|