C14H31N3O3 — CID 141497073
(2S)-2,6-diaminohexanoate;1-(2-methoxyethyl)-1-methylpyrrolidin-1-ium (PubChem CID 141497073) has the molecular formula C14H31N3O3 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoate;1-(2-methoxyethyl)-1-methylpyrrolidin-1-ium.
| Compound Name | (2S)-2,6-diaminohexanoate;1-(2-methoxyethyl)-1-methylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 141497073 |
| Molecular Formula | C14H31N3O3 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (2S)-2,6-diaminohexanoate;1-(2-methoxyethyl)-1-methylpyrrolidin-1-ium |
| SMILES | COCC[N+]1(C)CCCC1.NCCCC[C@H](N)C(=O)[O-] |
| InChI | InChI=1S/C8H18NO.C6H14N2O2/c1-9(7-8-10-2)5-3-4-6-9;7-4-2-1-3-5(8)6(9)10/h3-8H2,1-2H3;5H,1-4,7-8H2,(H,9,10)/q+1;/p-1/t;5-/m.0/s1 |
| InChIKey | UZEIFMHKOUMIPL-ZSCHJXSPSA-M |
| XLogP | -0.93 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|