C19H15N3O3 — CID 141497085
(3S,7'aS)-2'-phenylspiro[1H-indole-3,6'-7,7a-dihydro-5H-pyrrolo[1,2-c]imidazole]-1',2,3'-trione (PubChem CID 141497085) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (3S,7'aS)-2'-phenylspiro[1H-indole-3,6'-7,7a-dihydro-5H-pyrrolo[1,2-c]imidazole]-1',2,3'-trione.
| Compound Name | (3S,7'aS)-2'-phenylspiro[1H-indole-3,6'-7,7a-dihydro-5H-pyrrolo[1,2-c]imidazole]-1',2,3'-trione |
|---|---|
| PubChem CID | 141497085 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (3S,7'aS)-2'-phenylspiro[1H-indole-3,6'-7,7a-dihydro-5H-pyrrolo[1,2-c]imidazole]-1',2,3'-trione |
| SMILES | O=C1[C@@H]2C[C@]3(CN2C(=O)N1c1ccccc1)C(=O)Nc1ccccc13 |
| InChI | InChI=1S/C19H15N3O3/c23-16-15-10-19(13-8-4-5-9-14(13)20-17(19)24)11-21(15)18(25)22(16)12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H,20,24)/t15-,19+/m0/s1 |
| InChIKey | NHUIJDYWNWVADN-HNAYVOBHSA-N |
| XLogP | 2.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|