C14H12N4O2 — CID 14403674
(9S)-11-phenyl-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione (PubChem CID 14403674) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is (9S)-11-phenyl-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione.
| Compound Name | (9S)-11-phenyl-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
|---|---|
| PubChem CID | 14403674 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (9S)-11-phenyl-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-diene-10,12-dione |
| SMILES | O=C1[C@@H]2Cc3nc[nH]c3CN2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H12N4O2/c19-13-12-6-10-11(16-8-15-10)7-17(12)14(20)18(13)9-4-2-1-3-5-9/h1-5,8,12H,6-7H2,(H,15,16)/t12-/m0/s1 |
| InChIKey | YXWCJJKMTGPCKU-LBPRGKRZSA-N |
| XLogP | 1.30 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|