C17H16N4O4 — CID 14403697
ethyl 4-(10,12-dioxo-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-dien-11-yl)benzoate (PubChem CID 14403697) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is ethyl 4-(10,12-dioxo-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-dien-11-yl)benzoate.
| Compound Name | ethyl 4-(10,12-dioxo-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-dien-11-yl)benzoate |
|---|---|
| PubChem CID | 14403697 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | ethyl 4-(10,12-dioxo-1,4,6,11-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),5-dien-11-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Cc4nc[nH]c4CN3C2=O)cc1 |
| InChI | InChI=1S/C17H16N4O4/c1-2-25-16(23)10-3-5-11(6-4-10)21-15(22)14-7-12-13(19-9-18-12)8-20(14)17(21)24/h3-6,9,14H,2,7-8H2,1H3,(H,18,19) |
| InChIKey | ZUDPHMWMLZLBMG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|