C17H24N2O4 — CID 141499901
[2-acetyl-5-(1-morpholin-4-ylethyl)phenyl] N,N-dimethylcarbamate (PubChem CID 141499901) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is [2-acetyl-5-(1-morpholin-4-ylethyl)phenyl] N,N-dimethylcarbamate.
| Compound Name | [2-acetyl-5-(1-morpholin-4-ylethyl)phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 141499901 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | [2-acetyl-5-(1-morpholin-4-ylethyl)phenyl] N,N-dimethylcarbamate |
| SMILES | CC(=O)c1ccc(C(C)N2CCOCC2)cc1OC(=O)N(C)C |
| InChI | InChI=1S/C17H24N2O4/c1-12(19-7-9-22-10-8-19)14-5-6-15(13(2)20)16(11-14)23-17(21)18(3)4/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | ZFPAZSNUBPEADQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |