C5H8N2S — CID 14150994
1,3-bis(ethenyl)thiourea (PubChem CID 14150994) has the molecular formula C5H8N2S and a molecular weight of 128.20 g/mol. Its IUPAC name is 1,3-bis(ethenyl)thiourea.
| Compound Name | 1,3-bis(ethenyl)thiourea |
|---|---|
| PubChem CID | 14150994 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 1,3-bis(ethenyl)thiourea |
| SMILES | C=CNC(=S)NC=C |
| InChI | InChI=1S/C5H8N2S/c1-3-6-5(8)7-4-2/h3-4H,1-2H2,(H2,6,7,8) |
| InChIKey | DNNXAUGMZQMSEI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|