C3H5N3S — CID 57106218
4-amino-1,3-dihydroimidazole-2-thione (PubChem CID 57106218) has the molecular formula C3H5N3S and a molecular weight of 115.16 g/mol. Its IUPAC name is 4-amino-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-amino-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 57106218 |
| Molecular Formula | C3H5N3S |
| Molecular Weight | 115.16 g/mol |
| Exact Mass | 115.02 |
| IUPAC Name | 4-amino-1,3-dihydroimidazole-2-thione |
| SMILES | Nc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C3H5N3S/c4-2-1-5-3(7)6-2/h1H,4H2,(H2,5,6,7) |
| InChIKey | FFIXQDCUDZHOSL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|