C21H20N4O — CID 14153031
N-[2-methyl-2-(2-quinolin-4-yl-3H-benzimidazol-5-yl)propyl]formamide (PubChem CID 14153031) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[2-methyl-2-(2-quinolin-4-yl-3H-benzimidazol-5-yl)propyl]formamide.
| Compound Name | N-[2-methyl-2-(2-quinolin-4-yl-3H-benzimidazol-5-yl)propyl]formamide |
|---|---|
| PubChem CID | 14153031 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-[2-methyl-2-(2-quinolin-4-yl-3H-benzimidazol-5-yl)propyl]formamide |
| SMILES | CC(C)(CNC=O)c1ccc2nc(-c3ccnc4ccccc34)[nH]c2c1 |
| InChI | InChI=1S/C21H20N4O/c1-21(2,12-22-13-26)14-7-8-18-19(11-14)25-20(24-18)16-9-10-23-17-6-4-3-5-15(16)17/h3-11,13H,12H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | RUUCUQHVFZGIDH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|