C25H31FN4O10 — CID 14153509
[(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate (PubChem CID 14153509) has the molecular formula C25H31FN4O10 and a molecular weight of 566.54 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate.
| Compound Name | [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 14153509 |
| Molecular Formula | C25H31FN4O10 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](C)C(=O)OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H31FN4O10/c1-12(2)17(28-25(37)39-10-14-7-5-4-6-8-14)21(34)27-13(3)23(35)38-11-16-18(31)19(32)22(40-16)30-9-15(26)20(33)29-24(30)36/h4-9,12-13,16-19,22,31-32H,10-11H2,1-3H3,(H,27,34)(H,28,37)(H,29,33,36)/t13-,16+,17-,18+,19+,22+/m0/s1 |
| InChIKey | CZHGZHNTHOWUBE-WDMIXJASSA-N |
| XLogP | -0.71 |
| TPSA | 198.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |