C24H28O4 — CID 14164890
[(1S,3S,3aR,4S)-3-acetyl-7-methyl-6-oxo-4-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-1-yl] (E)-3-phenylprop-2-enoate (PubChem CID 14164890) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(1S,3S,3aR,4S)-3-acetyl-7-methyl-6-oxo-4-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-1-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S,3S,3aR,4S)-3-acetyl-7-methyl-6-oxo-4-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-1-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 14164890 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [(1S,3S,3aR,4S)-3-acetyl-7-methyl-6-oxo-4-propan-2-yl-1,2,3,3a,4,5-hexahydroinden-1-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(=O)[C@H]1C[C@H](OC(=O)/C=C/c2ccccc2)C2=C(C)C(=O)C[C@@H](C(C)C)[C@@H]21 |
| InChI | InChI=1S/C24H28O4/c1-14(2)18-12-20(26)15(3)23-21(13-19(16(4)25)24(18)23)28-22(27)11-10-17-8-6-5-7-9-17/h5-11,14,18-19,21,24H,12-13H2,1-4H3/b11-10+/t18-,19+,21-,24+/m0/s1 |
| InChIKey | RNGPYUPQJNOIRD-UNVMVFAHSA-N |
| XLogP | 4.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|