C19H28N2O2S — CID 14168435
N-[2-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]ethyl]-N-propylpropan-1-amine (PubChem CID 14168435) has the molecular formula C19H28N2O2S and a molecular weight of 348.51 g/mol. Its IUPAC name is N-[2-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]ethyl]-N-propylpropan-1-amine.
| Compound Name | N-[2-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]ethyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 14168435 |
| Molecular Formula | C19H28N2O2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | N-[2-[1-(4-methylphenyl)sulfonylpyrrol-3-yl]ethyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)CCc1ccn(S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C19H28N2O2S/c1-4-12-20(13-5-2)14-10-18-11-15-21(16-18)24(22,23)19-8-6-17(3)7-9-19/h6-9,11,15-16H,4-5,10,12-14H2,1-3H3 |
| InChIKey | NIUGDZLIUKUQMV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |