C21H18N4 — CID 14169712
(1S,2R,7S,8R,9R,11S)-1,8-dipyridin-2-yl-12,13-diazahexacyclo[6.3.2.02,7.03,5.04,6.09,11]tridec-12-ene (PubChem CID 14169712) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is (1S,2R,7S,8R,9R,11S)-1,8-dipyridin-2-yl-12,13-diazahexacyclo[6.3.2.02,7.03,5.04,6.09,11]tridec-12-ene.
| Compound Name | (1S,2R,7S,8R,9R,11S)-1,8-dipyridin-2-yl-12,13-diazahexacyclo[6.3.2.02,7.03,5.04,6.09,11]tridec-12-ene |
|---|---|
| PubChem CID | 14169712 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (1S,2R,7S,8R,9R,11S)-1,8-dipyridin-2-yl-12,13-diazahexacyclo[6.3.2.02,7.03,5.04,6.09,11]tridec-12-ene |
| SMILES | c1ccc([C@]23N=N[C@](c4ccccn4)([C@@H]4C[C@@H]42)[C@H]2C4C5C4C5[C@H]23)nc1 |
| InChI | InChI=1S/C21H18N4/c1-3-7-22-12(5-1)20-10-9-11(10)21(25-24-20,13-6-2-4-8-23-13)19-17-14-15(17)16(14)18(19)20/h1-8,10-11,14-19H,9H2/t10-,11+,14?,15?,16?,17?,18+,19-,20+,21- |
| InChIKey | UFYYCZNPLYEREX-UAWATZPSSA-N |
| XLogP | 3.42 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |