C25H36O8 — CID 14178983
(10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 14178983) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 14178983 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | (10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | CC12CCC3C(CC=C4CC(OC(=O)C5OC(O)C(O)C(O)C5O)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C25H36O8/c1-24-9-7-13(32-23(31)21-19(28)18(27)20(29)22(30)33-21)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h3,13-16,18-22,27-30H,4-11H2,1-2H3 |
| InChIKey | OQHLICVWICTZAI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|