C21H21N5O2S2 — CID 1419670
(2R)-2-[(7-methyl-8-oxo-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl)sulfanyl]-N-phenylpropanamide (PubChem CID 1419670) has the molecular formula C21H21N5O2S2 and a molecular weight of 439.57 g/mol. Its IUPAC name is (2R)-2-[(7-methyl-8-oxo-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl)sulfanyl]-N-phenylpropanamide.
| Compound Name | (2R)-2-[(7-methyl-8-oxo-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl)sulfanyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 1419670 |
| Molecular Formula | C21H21N5O2S2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | (2R)-2-[(7-methyl-8-oxo-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl)sulfanyl]-N-phenylpropanamide |
| SMILES | C[C@@H](Sc1nnc2n(C)c(=O)c3c4c(sc3n12)CCCC4)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H21N5O2S2/c1-12(17(27)22-13-8-4-3-5-9-13)29-21-24-23-20-25(2)18(28)16-14-10-6-7-11-15(14)30-19(16)26(20)21/h3-5,8-9,12H,6-7,10-11H2,1-2H3,(H,22,27)/t12-/m1/s1 |
| InChIKey | GEKIMBWRYIPDRR-GFCCVEGCSA-N |
| XLogP | 3.64 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |