C20H18N4O2S2 — CID 35205126
7-benzoyl-3-propylsulfanyl-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one (PubChem CID 35205126) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 7-benzoyl-3-propylsulfanyl-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one.
| Compound Name | 7-benzoyl-3-propylsulfanyl-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one |
|---|---|
| PubChem CID | 35205126 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 7-benzoyl-3-propylsulfanyl-15-thia-2,4,5,7-tetrazatetracyclo[7.6.0.02,6.010,14]pentadeca-1(9),3,5,10(14)-tetraen-8-one |
| SMILES | CCCSc1nnc2n(C(=O)c3ccccc3)c(=O)c3c4c(sc3n12)CCC4 |
| InChI | InChI=1S/C20H18N4O2S2/c1-2-11-27-20-22-21-19-23(16(25)12-7-4-3-5-8-12)17(26)15-13-9-6-10-14(13)28-18(15)24(19)20/h3-5,7-8H,2,6,9-11H2,1H3 |
| InChIKey | WFXGLCZSVGJRKH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 69.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |