C20H18N6S2 — CID 3694054
3-(2-phenylethylsulfanyl)-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene (PubChem CID 3694054) has the molecular formula C20H18N6S2 and a molecular weight of 406.54 g/mol. Its IUPAC name is 3-(2-phenylethylsulfanyl)-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene.
| Compound Name | 3-(2-phenylethylsulfanyl)-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene |
|---|---|
| PubChem CID | 3694054 |
| Molecular Formula | C20H18N6S2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 3-(2-phenylethylsulfanyl)-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaene |
| SMILES | c1ccc(CCSc2nnc3n4ncnc4c4c5c(sc4n23)CCCC5)cc1 |
| InChI | InChI=1S/C20H18N6S2/c1-2-6-13(7-3-1)10-11-27-20-24-23-19-25(20)18-16(17-21-12-22-26(17)19)14-8-4-5-9-15(14)28-18/h1-3,6-7,12H,4-5,8-11H2 |
| InChIKey | CDBPSVCILUSOJG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |