C19H19N5S — CID 3484643
N-(2-phenylethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine (PubChem CID 3484643) has the molecular formula C19H19N5S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(2-phenylethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine.
| Compound Name | N-(2-phenylethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine |
|---|---|
| PubChem CID | 3484643 |
| Molecular Formula | C19H19N5S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-(2-phenylethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine |
| SMILES | c1ccc(CCNc2nc3sc4c(c3c3ncnn23)CCCC4)cc1 |
| InChI | InChI=1S/C19H19N5S/c1-2-6-13(7-3-1)10-11-20-19-23-18-16(17-21-12-22-24(17)19)14-8-4-5-9-15(14)25-18/h1-3,6-7,12H,4-5,8-11H2,(H,20,23) |
| InChIKey | WURIMCVHQMDMSV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |