C17H23N6OS+ — CID 2034076
N-(2-morpholin-4-ium-4-ylethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine (PubChem CID 2034076) has the molecular formula C17H23N6OS+ and a molecular weight of 359.48 g/mol. Its IUPAC name is N-(2-morpholin-4-ium-4-ylethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine.
| Compound Name | N-(2-morpholin-4-ium-4-ylethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine |
|---|---|
| PubChem CID | 2034076 |
| Molecular Formula | C17H23N6OS+ |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-(2-morpholin-4-ium-4-ylethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine |
| SMILES | c1nc2c3c4c(sc3nc(NCC[NH+]3CCOCC3)n2n1)CCCC4 |
| InChI | InChI=1S/C17H22N6OS/c1-2-4-13-12(3-1)14-15-19-11-20-23(15)17(21-16(14)25-13)18-5-6-22-7-9-24-10-8-22/h11H,1-10H2,(H,18,21)/p+1 |
| InChIKey | NIAHHUPQTZQTLX-UHFFFAOYSA-O |
| XLogP | 0.54 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |