C27H24ClN5O2S2 — CID 155816332
3-[(7-benzyl-8-oxo-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl)sulfanyl]-N-(4-chlorophenyl)propanamide (PubChem CID 155816332) has the molecular formula C27H24ClN5O2S2 and a molecular weight of 550.11 g/mol. Its IUPAC name is 3-[(7-benzyl-8-oxo-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl)sulfanyl]-N-(4-chlorophenyl)propanamide.
| Compound Name | 3-[(7-benzyl-8-oxo-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl)sulfanyl]-N-(4-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 155816332 |
| Molecular Formula | C27H24ClN5O2S2 |
| Molecular Weight | 550.11 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 3-[(7-benzyl-8-oxo-16-thia-2,4,5,7-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15)-tetraen-3-yl)sulfanyl]-N-(4-chlorophenyl)propanamide |
| SMILES | O=C(CCSc1nnc2n(Cc3ccccc3)c(=O)c3c4c(sc3n12)CCCC4)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H24ClN5O2S2/c28-18-10-12-19(13-11-18)29-22(34)14-15-36-27-31-30-26-32(16-17-6-2-1-3-7-17)24(35)23-20-8-4-5-9-21(20)37-25(23)33(26)27/h1-3,6-7,10-13H,4-5,8-9,14-16H2,(H,29,34) |
| InChIKey | OAGBEKPJEKCWBA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.11 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |