About carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol
carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol (PubChem CID 142000064) has the molecular formula C10H13FO2S
and a molecular weight of 216.28 g/mol. Its IUPAC name is carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol.
Molecular Properties
| Compound Name | carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol |
| PubChem CID | 142000064 |
| Molecular Formula | C10H13FO2S |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol |
| SMILES | CCc1ccc(F)cc1.CS.O=C=O |
| InChI | InChI=1S/C8H9F.CO2.CH4S/c1-2-7-3-5-8(9)6-4-7;2-1-3;1-2/h3-6H,2H2,1H3;;2H,1H3 |
| InChIKey | YYDXWPLFGFQNRK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol?
The IUPAC name of carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol (CID 142000064) is carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol.
What is the SMILES notation for carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol?
The canonical SMILES for carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol is CCc1ccc(F)cc1.CS.O=C=O.
What is the InChIKey of carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol?
The InChIKey is YYDXWPLFGFQNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F.CO2.CH4S/c1-2-7-3-5-8(9)6-4-7;2-1-3;1-2/h3-6H,2H2,1H3;;2H,1H3.
What are the key properties of carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol?
carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol has a molecular weight of 216.28 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;1-ethyl-4-fluorobenzene;methanethiol is sourced from PubChem (CID 142000064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).