C9H19N — CID 142001409
(Z)-N,3-dimethylpent-2-en-1-imine;ethane (PubChem CID 142001409) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (Z)-N,3-dimethylpent-2-en-1-imine;ethane.
| Compound Name | (Z)-N,3-dimethylpent-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 142001409 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (Z)-N,3-dimethylpent-2-en-1-imine;ethane |
| SMILES | CC.CC/C(C)=C\C=N\C |
| InChI | InChI=1S/C7H13N.C2H6/c1-4-7(2)5-6-8-3;1-2/h5-6H,4H2,1-3H3;1-2H3/b7-5-,8-6+; |
| InChIKey | KFDIDHHYOKZXNW-KHCQPJBVSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|