About tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole
tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole (PubChem CID 142001419) has the molecular formula C22H33NO2
and a molecular weight of 343.51 g/mol. Its IUPAC name is tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole.
Molecular Properties
| Compound Name | tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole |
| PubChem CID | 142001419 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole |
| SMILES | CC(=O)OC(C)(C)C.CC/C=C(\CCC)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C16H21N.C6H12O2/c1-4-8-13(9-5-2)15-12-17(3)16-11-7-6-10-14(15)16;1-5(7)8-6(2,3)4/h6-8,10-12H,4-5,9H2,1-3H3;1-4H3/b13-8+; |
| InChIKey | VLGGHGRYNBFNMW-FNXZNAJJSA-N |
| XLogP | 6.12 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole?
The IUPAC name of tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole (CID 142001419) is tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole.
What is the SMILES notation for tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole?
The canonical SMILES for tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole is CC(=O)OC(C)(C)C.CC/C=C(\CCC)c1cn(C)c2ccccc12.
What is the InChIKey of tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole?
The InChIKey is VLGGHGRYNBFNMW-FNXZNAJJSA-N. The full InChI is InChI=1S/C16H21N.C6H12O2/c1-4-8-13(9-5-2)15-12-17(3)16-11-7-6-10-14(15)16;1-5(7)8-6(2,3)4/h6-8,10-12H,4-5,9H2,1-3H3;1-4H3/b13-8+;.
What are the key properties of tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole?
tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole has a molecular weight of 343.51 g/mol, XLogP of 6.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate;3-[(E)-hept-3-en-4-yl]-1-methylindole is sourced from PubChem (CID 142001419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).