C20H29NO — CID 142003040
(Z)-4-methyl-6-(2-methylphenyl)-4-(2-methylprop-2-enylamino)oct-6-en-3-one (PubChem CID 142003040) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (Z)-4-methyl-6-(2-methylphenyl)-4-(2-methylprop-2-enylamino)oct-6-en-3-one.
| Compound Name | (Z)-4-methyl-6-(2-methylphenyl)-4-(2-methylprop-2-enylamino)oct-6-en-3-one |
|---|---|
| PubChem CID | 142003040 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (Z)-4-methyl-6-(2-methylphenyl)-4-(2-methylprop-2-enylamino)oct-6-en-3-one |
| SMILES | C=C(C)CNC(C)(C/C(=C/C)c1ccccc1C)C(=O)CC |
| InChI | InChI=1S/C20H29NO/c1-7-17(18-12-10-9-11-16(18)5)13-20(6,19(22)8-2)21-14-15(3)4/h7,9-12,21H,3,8,13-14H2,1-2,4-6H3/b17-7- |
| InChIKey | WFUYOXWDVQQUIK-IDUWFGFVSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|