C12H11F3O2 — CID 82534474
(E)-5,5,5-trifluoro-3-(2-methylphenyl)pent-2-enoic acid (PubChem CID 82534474) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-3-(2-methylphenyl)pent-2-enoic acid.
| Compound Name | (E)-5,5,5-trifluoro-3-(2-methylphenyl)pent-2-enoic acid |
|---|---|
| PubChem CID | 82534474 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (E)-5,5,5-trifluoro-3-(2-methylphenyl)pent-2-enoic acid |
| SMILES | Cc1ccccc1/C(=C/C(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C12H11F3O2/c1-8-4-2-3-5-10(8)9(6-11(16)17)7-12(13,14)15/h2-6H,7H2,1H3,(H,16,17)/b9-6+ |
| InChIKey | AOTMZIVPJUAIPY-RMKNXTFCSA-N |
| XLogP | 3.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|