C28H28O4 — CID 142003075
acetic acid;[(3Z)-2-ethyl-7-methoxy-3-[(2-phenylphenyl)methylidene]inden-1-yl]methanol (PubChem CID 142003075) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is acetic acid;[(3Z)-2-ethyl-7-methoxy-3-[(2-phenylphenyl)methylidene]inden-1-yl]methanol.
| Compound Name | acetic acid;[(3Z)-2-ethyl-7-methoxy-3-[(2-phenylphenyl)methylidene]inden-1-yl]methanol |
|---|---|
| PubChem CID | 142003075 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | acetic acid;[(3Z)-2-ethyl-7-methoxy-3-[(2-phenylphenyl)methylidene]inden-1-yl]methanol |
| SMILES | CC(=O)O.CCC1=C(CO)c2c(OC)cccc2/C1=C\c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H24O2.C2H4O2/c1-3-20-23(22-14-9-15-25(28-2)26(22)24(20)17-27)16-19-12-7-8-13-21(19)18-10-5-4-6-11-18;1-2(3)4/h4-16,27H,3,17H2,1-2H3;1H3,(H,3,4)/b23-16-; |
| InChIKey | CELXIVKFCDXIPV-YGCQTIHHSA-N |
| XLogP | 6.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|