C21H30ClN3O3 — CID 142003127
ethane;methyl 2-amino-3-[4-[(6-chloro-2-methylpyridine-3-carbonyl)amino]phenyl]propanoate (PubChem CID 142003127) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is ethane;methyl 2-amino-3-[4-[(6-chloro-2-methylpyridine-3-carbonyl)amino]phenyl]propanoate.
| Compound Name | ethane;methyl 2-amino-3-[4-[(6-chloro-2-methylpyridine-3-carbonyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 142003127 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | ethane;methyl 2-amino-3-[4-[(6-chloro-2-methylpyridine-3-carbonyl)amino]phenyl]propanoate |
| SMILES | CC.CC.COC(=O)C(N)Cc1ccc(NC(=O)c2ccc(Cl)nc2C)cc1 |
| InChI | InChI=1S/C17H18ClN3O3.2C2H6/c1-10-13(7-8-15(18)20-10)16(22)21-12-5-3-11(4-6-12)9-14(19)17(23)24-2;2*1-2/h3-8,14H,9,19H2,1-2H3,(H,21,22);2*1-2H3 |
| InChIKey | AMONFIAUGCVBLP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|