About N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane
N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane (PubChem CID 142005093) has the molecular formula C29H29ClN2O2
and a molecular weight of 473.02 g/mol. Its IUPAC name is N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane.
Molecular Properties
| Compound Name | N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane |
| PubChem CID | 142005093 |
| Molecular Formula | C29H29ClN2O2 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane |
| SMILES | CC.CC(=O)c1ccccc1NC(=O)c1ccc(-c2ccccc2)cc1.Cc1ccc(Cl)cn1 |
| InChI | InChI=1S/C21H17NO2.C6H6ClN.C2H6/c1-15(23)19-9-5-6-10-20(19)22-21(24)18-13-11-17(12-14-18)16-7-3-2-4-8-16;1-5-2-3-6(7)4-8-5;1-2/h2-14H,1H3,(H,22,24);2-4H,1H3;1-2H3 |
| InChIKey | MLCNAGSXHSCADK-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane?
The IUPAC name of N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane (CID 142005093) is N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane.
What is the SMILES notation for N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane?
The canonical SMILES for N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane is CC.CC(=O)c1ccccc1NC(=O)c1ccc(-c2ccccc2)cc1.Cc1ccc(Cl)cn1.
What is the InChIKey of N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane?
The InChIKey is MLCNAGSXHSCADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2.C6H6ClN.C2H6/c1-15(23)19-9-5-6-10-20(19)22-21(24)18-13-11-17(12-14-18)16-7-3-2-4-8-16;1-5-2-3-6(7)4-8-5;1-2/h2-14H,1H3,(H,22,24);2-4H,1H3;1-2H3.
What are the key properties of N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane?
N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane has a molecular weight of 473.02 g/mol, XLogP of 7.88, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-acetylphenyl)-4-phenylbenzamide;5-chloro-2-methylpyridine;ethane is sourced from PubChem (CID 142005093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).