C27H37F2NO — CID 142006547
bis(4-fluorophenyl)methanol;N-[(Z)-1-cyclohexylbut-1-enyl]ethanimine;ethane (PubChem CID 142006547) has the molecular formula C27H37F2NO and a molecular weight of 429.60 g/mol. Its IUPAC name is bis(4-fluorophenyl)methanol;N-[(Z)-1-cyclohexylbut-1-enyl]ethanimine;ethane.
| Compound Name | bis(4-fluorophenyl)methanol;N-[(Z)-1-cyclohexylbut-1-enyl]ethanimine;ethane |
|---|---|
| PubChem CID | 142006547 |
| Molecular Formula | C27H37F2NO |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | bis(4-fluorophenyl)methanol;N-[(Z)-1-cyclohexylbut-1-enyl]ethanimine;ethane |
| SMILES | C/C=N/C(=C\CC)C1CCCCC1.CC.OC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H10F2O.C12H21N.C2H6/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10;1-3-8-12(13-4-2)11-9-6-5-7-10-11;1-2/h1-8,13,16H;4,8,11H,3,5-7,9-10H2,1-2H3;1-2H3/b;12-8-,13-4+; |
| InChIKey | YVIXHANECFROGQ-PEYQIDRUSA-N |
| XLogP | 8.02 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|