C22H24FNO — CID 57010627
2-[2-[4-(4-fluorophenyl)butan-2-yl]pyrrol-2-yl]-1-phenylethanol (PubChem CID 57010627) has the molecular formula C22H24FNO and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-[2-[4-(4-fluorophenyl)butan-2-yl]pyrrol-2-yl]-1-phenylethanol.
| Compound Name | 2-[2-[4-(4-fluorophenyl)butan-2-yl]pyrrol-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 57010627 |
| Molecular Formula | C22H24FNO |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-[2-[4-(4-fluorophenyl)butan-2-yl]pyrrol-2-yl]-1-phenylethanol |
| SMILES | CC(CCc1ccc(F)cc1)C1(CC(O)c2ccccc2)C=CC=N1 |
| InChI | InChI=1S/C22H24FNO/c1-17(8-9-18-10-12-20(23)13-11-18)22(14-5-15-24-22)16-21(25)19-6-3-2-4-7-19/h2-7,10-15,17,21,25H,8-9,16H2,1H3 |
| InChIKey | MITMTEYZSTYYNJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |